C29H26Cl2N2O6 — CID 19123951
[2-amino-3-cyano-4-(3,4-diethoxyphenyl)-4H-chromen-7-yl] 3,5-dichloro-4-ethoxybenzoate (PubChem CID 19123951) has the molecular formula C29H26Cl2N2O6 and a molecular weight of 569.44 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(3,4-diethoxyphenyl)-4H-chromen-7-yl] 3,5-dichloro-4-ethoxybenzoate.
| Compound Name | [2-amino-3-cyano-4-(3,4-diethoxyphenyl)-4H-chromen-7-yl] 3,5-dichloro-4-ethoxybenzoate |
|---|---|
| PubChem CID | 19123951 |
| Molecular Formula | C29H26Cl2N2O6 |
| Molecular Weight | 569.44 g/mol |
| Exact Mass | 568.12 |
| IUPAC Name | [2-amino-3-cyano-4-(3,4-diethoxyphenyl)-4H-chromen-7-yl] 3,5-dichloro-4-ethoxybenzoate |
| SMILES | CCOc1ccc(C2C(C#N)=C(N)Oc3cc(OC(=O)c4cc(Cl)c(OCC)c(Cl)c4)ccc32)cc1OCC |
| InChI | InChI=1S/C29H26Cl2N2O6/c1-4-35-23-10-7-16(13-25(23)36-5-2)26-19-9-8-18(14-24(19)39-28(33)20(26)15-32)38-29(34)17-11-21(30)27(37-6-3)22(31)12-17/h7-14,26H,4-6,33H2,1-3H3 |
| InChIKey | NQNAVYVECQBFLE-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 113.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.44 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|