C36H30Cl4N2O6 — CID 19130080
[2-amino-3-cyano-4-[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]-4H-chromen-7-yl] 4-butoxy-3,5-dichlorobenzoate (PubChem CID 19130080) has the molecular formula C36H30Cl4N2O6 and a molecular weight of 728.46 g/mol. Its IUPAC name is [2-amino-3-cyano-4-[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]-4H-chromen-7-yl] 4-butoxy-3,5-dichlorobenzoate.
| Compound Name | [2-amino-3-cyano-4-[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]-4H-chromen-7-yl] 4-butoxy-3,5-dichlorobenzoate |
|---|---|
| PubChem CID | 19130080 |
| Molecular Formula | C36H30Cl4N2O6 |
| Molecular Weight | 728.46 g/mol |
| Exact Mass | 726.09 |
| IUPAC Name | [2-amino-3-cyano-4-[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]-4H-chromen-7-yl] 4-butoxy-3,5-dichlorobenzoate |
| SMILES | CCCCOc1c(Cl)cc(C(=O)Oc2ccc3c(c2)OC(N)=C(C#N)C3c2ccc(OCc3ccc(Cl)cc3Cl)c(OCC)c2)cc1Cl |
| InChI | InChI=1S/C36H30Cl4N2O6/c1-3-5-12-45-34-28(39)13-22(14-29(34)40)36(43)47-24-9-10-25-31(17-24)48-35(42)26(18-41)33(25)20-7-11-30(32(15-20)44-4-2)46-19-21-6-8-23(37)16-27(21)38/h6-11,13-17,33H,3-5,12,19,42H2,1-2H3 |
| InChIKey | OZWKTRFMNHWQTA-UHFFFAOYSA-N |
| XLogP | 9.89 |
| TPSA | 113.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.46 |
| LogP ≤ 5 | 9.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|