C33H26Cl2N2O5 — CID 19127817
[2-amino-3-cyano-4-[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]-4H-chromen-7-yl] 4-methylbenzoate (PubChem CID 19127817) has the molecular formula C33H26Cl2N2O5 and a molecular weight of 601.49 g/mol. Its IUPAC name is [2-amino-3-cyano-4-[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]-4H-chromen-7-yl] 4-methylbenzoate.
| Compound Name | [2-amino-3-cyano-4-[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]-4H-chromen-7-yl] 4-methylbenzoate |
|---|---|
| PubChem CID | 19127817 |
| Molecular Formula | C33H26Cl2N2O5 |
| Molecular Weight | 601.49 g/mol |
| Exact Mass | 600.12 |
| IUPAC Name | [2-amino-3-cyano-4-[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]-4H-chromen-7-yl] 4-methylbenzoate |
| SMILES | CCOc1cc(C2C(C#N)=C(N)Oc3cc(OC(=O)c4ccc(C)cc4)ccc32)ccc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C33H26Cl2N2O5/c1-3-39-30-14-21(9-13-28(30)40-18-22-8-10-23(34)15-27(22)35)31-25-12-11-24(16-29(25)42-32(37)26(31)17-36)41-33(38)20-6-4-19(2)5-7-20/h4-16,31H,3,18,37H2,1-2H3 |
| InChIKey | RPXLTPIRLZLLFX-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 103.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.49 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|