C31H28Cl2N2O6 — CID 19128976
[2-amino-3-cyano-4-(3-methoxy-4-prop-2-enoxyphenyl)-4H-chromen-7-yl] 4-butoxy-3,5-dichlorobenzoate (PubChem CID 19128976) has the molecular formula C31H28Cl2N2O6 and a molecular weight of 595.48 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(3-methoxy-4-prop-2-enoxyphenyl)-4H-chromen-7-yl] 4-butoxy-3,5-dichlorobenzoate.
| Compound Name | [2-amino-3-cyano-4-(3-methoxy-4-prop-2-enoxyphenyl)-4H-chromen-7-yl] 4-butoxy-3,5-dichlorobenzoate |
|---|---|
| PubChem CID | 19128976 |
| Molecular Formula | C31H28Cl2N2O6 |
| Molecular Weight | 595.48 g/mol |
| Exact Mass | 594.13 |
| IUPAC Name | [2-amino-3-cyano-4-(3-methoxy-4-prop-2-enoxyphenyl)-4H-chromen-7-yl] 4-butoxy-3,5-dichlorobenzoate |
| SMILES | C=CCOc1ccc(C2C(C#N)=C(N)Oc3cc(OC(=O)c4cc(Cl)c(OCCCC)c(Cl)c4)ccc32)cc1OC |
| InChI | InChI=1S/C31H28Cl2N2O6/c1-4-6-12-39-29-23(32)13-19(14-24(29)33)31(36)40-20-8-9-21-26(16-20)41-30(35)22(17-34)28(21)18-7-10-25(38-11-5-2)27(15-18)37-3/h5,7-10,13-16,28H,2,4,6,11-12,35H2,1,3H3 |
| InChIKey | SMBBJSRSMNITSW-UHFFFAOYSA-N |
| XLogP | 7.18 |
| TPSA | 113.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.48 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|