C30H28N2O8 — CID 19124173
[2-amino-3-cyano-4-(3-methoxy-4-prop-2-enoxyphenyl)-4H-chromen-7-yl] 3,4,5-trimethoxybenzoate (PubChem CID 19124173) has the molecular formula C30H28N2O8 and a molecular weight of 544.56 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(3-methoxy-4-prop-2-enoxyphenyl)-4H-chromen-7-yl] 3,4,5-trimethoxybenzoate.
| Compound Name | [2-amino-3-cyano-4-(3-methoxy-4-prop-2-enoxyphenyl)-4H-chromen-7-yl] 3,4,5-trimethoxybenzoate |
|---|---|
| PubChem CID | 19124173 |
| Molecular Formula | C30H28N2O8 |
| Molecular Weight | 544.56 g/mol |
| Exact Mass | 544.18 |
| IUPAC Name | [2-amino-3-cyano-4-(3-methoxy-4-prop-2-enoxyphenyl)-4H-chromen-7-yl] 3,4,5-trimethoxybenzoate |
| SMILES | C=CCOc1ccc(C2C(C#N)=C(N)Oc3cc(OC(=O)c4cc(OC)c(OC)c(OC)c4)ccc32)cc1OC |
| InChI | InChI=1S/C30H28N2O8/c1-6-11-38-22-10-7-17(12-24(22)34-2)27-20-9-8-19(15-23(20)40-29(32)21(27)16-31)39-30(33)18-13-25(35-3)28(37-5)26(14-18)36-4/h6-10,12-15,27H,1,11,32H2,2-5H3 |
| InChIKey | ZFZYAEYNHVKNFQ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 131.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.56 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|