C29H20Cl2N2O5S — CID 19128966
[2-amino-3-cyano-4-(3-methoxy-4-prop-2-enoxyphenyl)-4H-chromen-7-yl] 3,6-dichloro-1-benzothiophene-2-carboxylate (PubChem CID 19128966) has the molecular formula C29H20Cl2N2O5S and a molecular weight of 579.46 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(3-methoxy-4-prop-2-enoxyphenyl)-4H-chromen-7-yl] 3,6-dichloro-1-benzothiophene-2-carboxylate.
| Compound Name | [2-amino-3-cyano-4-(3-methoxy-4-prop-2-enoxyphenyl)-4H-chromen-7-yl] 3,6-dichloro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 19128966 |
| Molecular Formula | C29H20Cl2N2O5S |
| Molecular Weight | 579.46 g/mol |
| Exact Mass | 578.05 |
| IUPAC Name | [2-amino-3-cyano-4-(3-methoxy-4-prop-2-enoxyphenyl)-4H-chromen-7-yl] 3,6-dichloro-1-benzothiophene-2-carboxylate |
| SMILES | C=CCOc1ccc(C2C(C#N)=C(N)Oc3cc(OC(=O)c4sc5cc(Cl)ccc5c4Cl)ccc32)cc1OC |
| InChI | InChI=1S/C29H20Cl2N2O5S/c1-3-10-36-21-9-4-15(11-23(21)35-2)25-18-8-6-17(13-22(18)38-28(33)20(25)14-32)37-29(34)27-26(31)19-7-5-16(30)12-24(19)39-27/h3-9,11-13,25H,1,10,33H2,2H3 |
| InChIKey | HFLXHRJJAGLZJV-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 103.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.46 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|