C29H21ClN2O4S — CID 19128509
[2-amino-3-cyano-4-(4-prop-2-enoxyphenyl)-4H-chromen-7-yl] 3-chloro-6-methyl-1-benzothiophene-2-carboxylate (PubChem CID 19128509) has the molecular formula C29H21ClN2O4S and a molecular weight of 529.02 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(4-prop-2-enoxyphenyl)-4H-chromen-7-yl] 3-chloro-6-methyl-1-benzothiophene-2-carboxylate.
| Compound Name | [2-amino-3-cyano-4-(4-prop-2-enoxyphenyl)-4H-chromen-7-yl] 3-chloro-6-methyl-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 19128509 |
| Molecular Formula | C29H21ClN2O4S |
| Molecular Weight | 529.02 g/mol |
| Exact Mass | 528.09 |
| IUPAC Name | [2-amino-3-cyano-4-(4-prop-2-enoxyphenyl)-4H-chromen-7-yl] 3-chloro-6-methyl-1-benzothiophene-2-carboxylate |
| SMILES | C=CCOc1ccc(C2C(C#N)=C(N)Oc3cc(OC(=O)c4sc5cc(C)ccc5c4Cl)ccc32)cc1 |
| InChI | InChI=1S/C29H21ClN2O4S/c1-3-12-34-18-7-5-17(6-8-18)25-20-11-9-19(14-23(20)36-28(32)22(25)15-31)35-29(33)27-26(30)21-10-4-16(2)13-24(21)37-27/h3-11,13-14,25H,1,12,32H2,2H3 |
| InChIKey | QPQHLRHPGUACNT-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 94.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.02 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|