C31H27ClN2O4S — CID 19129325
[2-amino-3-cyano-4-(3-pentoxyphenyl)-4H-chromen-7-yl] 3-chloro-6-methyl-1-benzothiophene-2-carboxylate (PubChem CID 19129325) has the molecular formula C31H27ClN2O4S and a molecular weight of 559.09 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(3-pentoxyphenyl)-4H-chromen-7-yl] 3-chloro-6-methyl-1-benzothiophene-2-carboxylate.
| Compound Name | [2-amino-3-cyano-4-(3-pentoxyphenyl)-4H-chromen-7-yl] 3-chloro-6-methyl-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 19129325 |
| Molecular Formula | C31H27ClN2O4S |
| Molecular Weight | 559.09 g/mol |
| Exact Mass | 558.14 |
| IUPAC Name | [2-amino-3-cyano-4-(3-pentoxyphenyl)-4H-chromen-7-yl] 3-chloro-6-methyl-1-benzothiophene-2-carboxylate |
| SMILES | CCCCCOc1cccc(C2C(C#N)=C(N)Oc3cc(OC(=O)c4sc5cc(C)ccc5c4Cl)ccc32)c1 |
| InChI | InChI=1S/C31H27ClN2O4S/c1-3-4-5-13-36-20-8-6-7-19(15-20)27-22-12-10-21(16-25(22)38-30(34)24(27)17-33)37-31(35)29-28(32)23-11-9-18(2)14-26(23)39-29/h6-12,14-16,27H,3-5,13,34H2,1-2H3 |
| InChIKey | GSRJXSAWUPXPME-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 94.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.09 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|