C27H19ClN2O4S — CID 19128005
[2-amino-3-cyano-4-(3-methoxyphenyl)-4H-chromen-7-yl] 3-chloro-6-methyl-1-benzothiophene-2-carboxylate (PubChem CID 19128005) has the molecular formula C27H19ClN2O4S and a molecular weight of 502.98 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(3-methoxyphenyl)-4H-chromen-7-yl] 3-chloro-6-methyl-1-benzothiophene-2-carboxylate.
| Compound Name | [2-amino-3-cyano-4-(3-methoxyphenyl)-4H-chromen-7-yl] 3-chloro-6-methyl-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 19128005 |
| Molecular Formula | C27H19ClN2O4S |
| Molecular Weight | 502.98 g/mol |
| Exact Mass | 502.08 |
| IUPAC Name | [2-amino-3-cyano-4-(3-methoxyphenyl)-4H-chromen-7-yl] 3-chloro-6-methyl-1-benzothiophene-2-carboxylate |
| SMILES | COc1cccc(C2C(C#N)=C(N)Oc3cc(OC(=O)c4sc5cc(C)ccc5c4Cl)ccc32)c1 |
| InChI | InChI=1S/C27H19ClN2O4S/c1-14-6-8-19-22(10-14)35-25(24(19)28)27(31)33-17-7-9-18-21(12-17)34-26(30)20(13-29)23(18)15-4-3-5-16(11-15)32-2/h3-12,23H,30H2,1-2H3 |
| InChIKey | BQOUSERFGDMHKA-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 94.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.98 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|