C32H21ClN2O4S — CID 19129636
[2-amino-3-cyano-4-(3-phenylmethoxyphenyl)-4H-chromen-7-yl] 3-chloro-1-benzothiophene-2-carboxylate (PubChem CID 19129636) has the molecular formula C32H21ClN2O4S and a molecular weight of 565.05 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(3-phenylmethoxyphenyl)-4H-chromen-7-yl] 3-chloro-1-benzothiophene-2-carboxylate.
| Compound Name | [2-amino-3-cyano-4-(3-phenylmethoxyphenyl)-4H-chromen-7-yl] 3-chloro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 19129636 |
| Molecular Formula | C32H21ClN2O4S |
| Molecular Weight | 565.05 g/mol |
| Exact Mass | 564.09 |
| IUPAC Name | [2-amino-3-cyano-4-(3-phenylmethoxyphenyl)-4H-chromen-7-yl] 3-chloro-1-benzothiophene-2-carboxylate |
| SMILES | N#CC1=C(N)Oc2cc(OC(=O)c3sc4ccccc4c3Cl)ccc2C1c1cccc(OCc2ccccc2)c1 |
| InChI | InChI=1S/C32H21ClN2O4S/c33-29-24-11-4-5-12-27(24)40-30(29)32(36)38-22-13-14-23-26(16-22)39-31(35)25(17-34)28(23)20-9-6-10-21(15-20)37-18-19-7-2-1-3-8-19/h1-16,28H,18,35H2 |
| InChIKey | GUBQSPBUAOHATK-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 94.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.05 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|