C32H20ClFN2O4S — CID 19129564
[2-amino-3-cyano-4-[4-[(2-fluorophenyl)methoxy]phenyl]-4H-chromen-7-yl] 3-chloro-1-benzothiophene-2-carboxylate (PubChem CID 19129564) has the molecular formula C32H20ClFN2O4S and a molecular weight of 583.04 g/mol. Its IUPAC name is [2-amino-3-cyano-4-[4-[(2-fluorophenyl)methoxy]phenyl]-4H-chromen-7-yl] 3-chloro-1-benzothiophene-2-carboxylate.
| Compound Name | [2-amino-3-cyano-4-[4-[(2-fluorophenyl)methoxy]phenyl]-4H-chromen-7-yl] 3-chloro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 19129564 |
| Molecular Formula | C32H20ClFN2O4S |
| Molecular Weight | 583.04 g/mol |
| Exact Mass | 582.08 |
| IUPAC Name | [2-amino-3-cyano-4-[4-[(2-fluorophenyl)methoxy]phenyl]-4H-chromen-7-yl] 3-chloro-1-benzothiophene-2-carboxylate |
| SMILES | N#CC1=C(N)Oc2cc(OC(=O)c3sc4ccccc4c3Cl)ccc2C1c1ccc(OCc2ccccc2F)cc1 |
| InChI | InChI=1S/C32H20ClFN2O4S/c33-29-23-6-2-4-8-27(23)41-30(29)32(37)39-21-13-14-22-26(15-21)40-31(36)24(16-35)28(22)18-9-11-20(12-10-18)38-17-19-5-1-3-7-25(19)34/h1-15,28H,17,36H2 |
| InChIKey | ZPOZBYKGZLSREF-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 94.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.04 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|