C25H14ClFN2O3S — CID 19128268
[2-amino-3-cyano-4-(2-fluorophenyl)-4H-chromen-7-yl] 3-chloro-1-benzothiophene-2-carboxylate (PubChem CID 19128268) has the molecular formula C25H14ClFN2O3S and a molecular weight of 476.92 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(2-fluorophenyl)-4H-chromen-7-yl] 3-chloro-1-benzothiophene-2-carboxylate.
| Compound Name | [2-amino-3-cyano-4-(2-fluorophenyl)-4H-chromen-7-yl] 3-chloro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 19128268 |
| Molecular Formula | C25H14ClFN2O3S |
| Molecular Weight | 476.92 g/mol |
| Exact Mass | 476.04 |
| IUPAC Name | [2-amino-3-cyano-4-(2-fluorophenyl)-4H-chromen-7-yl] 3-chloro-1-benzothiophene-2-carboxylate |
| SMILES | N#CC1=C(N)Oc2cc(OC(=O)c3sc4ccccc4c3Cl)ccc2C1c1ccccc1F |
| InChI | InChI=1S/C25H14ClFN2O3S/c26-22-16-6-2-4-8-20(16)33-23(22)25(30)31-13-9-10-15-19(11-13)32-24(29)17(12-28)21(15)14-5-1-3-7-18(14)27/h1-11,21H,29H2 |
| InChIKey | OWNBRHKXAGSDRR-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 85.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.92 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|