C23H12Cl2N2O3S2 — CID 19128414
(2-amino-3-cyano-4-thiophen-2-yl-4H-chromen-7-yl) 3,6-dichloro-1-benzothiophene-2-carboxylate (PubChem CID 19128414) has the molecular formula C23H12Cl2N2O3S2 and a molecular weight of 499.40 g/mol. Its IUPAC name is (2-amino-3-cyano-4-thiophen-2-yl-4H-chromen-7-yl) 3,6-dichloro-1-benzothiophene-2-carboxylate.
| Compound Name | (2-amino-3-cyano-4-thiophen-2-yl-4H-chromen-7-yl) 3,6-dichloro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 19128414 |
| Molecular Formula | C23H12Cl2N2O3S2 |
| Molecular Weight | 499.40 g/mol |
| Exact Mass | 497.97 |
| IUPAC Name | (2-amino-3-cyano-4-thiophen-2-yl-4H-chromen-7-yl) 3,6-dichloro-1-benzothiophene-2-carboxylate |
| SMILES | N#CC1=C(N)Oc2cc(OC(=O)c3sc4cc(Cl)ccc4c3Cl)ccc2C1c1cccs1 |
| InChI | InChI=1S/C23H12Cl2N2O3S2/c24-11-3-5-14-18(8-11)32-21(20(14)25)23(28)29-12-4-6-13-16(9-12)30-22(27)15(10-26)19(13)17-2-1-7-31-17/h1-9,19H,27H2 |
| InChIKey | FLRQNYFEBUWZKY-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 85.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.40 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|