C21H12Cl2N2O3S — CID 19122170
[2-amino-3-cyano-4-(2,4-dichlorophenyl)-4H-chromen-7-yl] thiophene-2-carboxylate (PubChem CID 19122170) has the molecular formula C21H12Cl2N2O3S and a molecular weight of 443.31 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(2,4-dichlorophenyl)-4H-chromen-7-yl] thiophene-2-carboxylate.
| Compound Name | [2-amino-3-cyano-4-(2,4-dichlorophenyl)-4H-chromen-7-yl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 19122170 |
| Molecular Formula | C21H12Cl2N2O3S |
| Molecular Weight | 443.31 g/mol |
| Exact Mass | 441.99 |
| IUPAC Name | [2-amino-3-cyano-4-(2,4-dichlorophenyl)-4H-chromen-7-yl] thiophene-2-carboxylate |
| SMILES | N#CC1=C(N)Oc2cc(OC(=O)c3cccs3)ccc2C1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C21H12Cl2N2O3S/c22-11-3-5-13(16(23)8-11)19-14-6-4-12(27-21(26)18-2-1-7-29-18)9-17(14)28-20(25)15(19)10-24/h1-9,19H,25H2 |
| InChIKey | ADCJWAOPQZKMDQ-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 85.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.31 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|