C28H24Cl2N2O4 — CID 19122208
[2-amino-3-cyano-4-(2,4-dichlorophenyl)-4H-chromen-7-yl] 2-(4-propan-2-ylphenoxy)propanoate (PubChem CID 19122208) has the molecular formula C28H24Cl2N2O4 and a molecular weight of 523.42 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(2,4-dichlorophenyl)-4H-chromen-7-yl] 2-(4-propan-2-ylphenoxy)propanoate.
| Compound Name | [2-amino-3-cyano-4-(2,4-dichlorophenyl)-4H-chromen-7-yl] 2-(4-propan-2-ylphenoxy)propanoate |
|---|---|
| PubChem CID | 19122208 |
| Molecular Formula | C28H24Cl2N2O4 |
| Molecular Weight | 523.42 g/mol |
| Exact Mass | 522.11 |
| IUPAC Name | [2-amino-3-cyano-4-(2,4-dichlorophenyl)-4H-chromen-7-yl] 2-(4-propan-2-ylphenoxy)propanoate |
| SMILES | CC(Oc1ccc(C(C)C)cc1)C(=O)Oc1ccc2c(c1)OC(N)=C(C#N)C2c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C28H24Cl2N2O4/c1-15(2)17-4-7-19(8-5-17)34-16(3)28(33)35-20-9-11-22-25(13-20)36-27(32)23(14-31)26(22)21-10-6-18(29)12-24(21)30/h4-13,15-16,26H,32H2,1-3H3 |
| InChIKey | DFJJSKOUPWBTDH-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 94.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.42 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|