C24H16Cl2N2O3 — CID 19122142
[2-amino-3-cyano-4-(2,4-dichlorophenyl)-4H-chromen-7-yl] 4-methylbenzoate (PubChem CID 19122142) has the molecular formula C24H16Cl2N2O3 and a molecular weight of 451.31 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(2,4-dichlorophenyl)-4H-chromen-7-yl] 4-methylbenzoate.
| Compound Name | [2-amino-3-cyano-4-(2,4-dichlorophenyl)-4H-chromen-7-yl] 4-methylbenzoate |
|---|---|
| PubChem CID | 19122142 |
| Molecular Formula | C24H16Cl2N2O3 |
| Molecular Weight | 451.31 g/mol |
| Exact Mass | 450.05 |
| IUPAC Name | [2-amino-3-cyano-4-(2,4-dichlorophenyl)-4H-chromen-7-yl] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)Oc2ccc3c(c2)OC(N)=C(C#N)C3c2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C24H16Cl2N2O3/c1-13-2-4-14(5-3-13)24(29)30-16-7-9-18-21(11-16)31-23(28)19(12-27)22(18)17-8-6-15(25)10-20(17)26/h2-11,22H,28H2,1H3 |
| InChIKey | YJUXBINWHLVRCB-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 85.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.31 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|