C24H11Cl7N2O4 — CID 19122212
[2-amino-3-cyano-4-(2,4-dichlorophenyl)-4H-chromen-7-yl] 2-(2,3,4,5,6-pentachlorophenoxy)acetate (PubChem CID 19122212) has the molecular formula C24H11Cl7N2O4 and a molecular weight of 639.53 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(2,4-dichlorophenyl)-4H-chromen-7-yl] 2-(2,3,4,5,6-pentachlorophenoxy)acetate.
| Compound Name | [2-amino-3-cyano-4-(2,4-dichlorophenyl)-4H-chromen-7-yl] 2-(2,3,4,5,6-pentachlorophenoxy)acetate |
|---|---|
| PubChem CID | 19122212 |
| Molecular Formula | C24H11Cl7N2O4 |
| Molecular Weight | 639.53 g/mol |
| Exact Mass | 635.85 |
| IUPAC Name | [2-amino-3-cyano-4-(2,4-dichlorophenyl)-4H-chromen-7-yl] 2-(2,3,4,5,6-pentachlorophenoxy)acetate |
| SMILES | N#CC1=C(N)Oc2cc(OC(=O)COc3c(Cl)c(Cl)c(Cl)c(Cl)c3Cl)ccc2C1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C24H11Cl7N2O4/c25-9-1-3-11(14(26)5-9)17-12-4-2-10(6-15(12)37-24(33)13(17)7-32)36-16(34)8-35-23-21(30)19(28)18(27)20(29)22(23)31/h1-6,17H,8,33H2 |
| InChIKey | AJDKPNBBJFYOEA-UHFFFAOYSA-N |
| XLogP | 8.46 |
| TPSA | 94.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.53 |
| LogP ≤ 5 | 8.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|