C22H16N2O4S — CID 19121054
[2-amino-3-cyano-4-(4-methoxyphenyl)-4H-chromen-7-yl] thiophene-2-carboxylate (PubChem CID 19121054) has the molecular formula C22H16N2O4S and a molecular weight of 404.45 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(4-methoxyphenyl)-4H-chromen-7-yl] thiophene-2-carboxylate.
| Compound Name | [2-amino-3-cyano-4-(4-methoxyphenyl)-4H-chromen-7-yl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 19121054 |
| Molecular Formula | C22H16N2O4S |
| Molecular Weight | 404.45 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | [2-amino-3-cyano-4-(4-methoxyphenyl)-4H-chromen-7-yl] thiophene-2-carboxylate |
| SMILES | COc1ccc(C2C(C#N)=C(N)Oc3cc(OC(=O)c4cccs4)ccc32)cc1 |
| InChI | InChI=1S/C22H16N2O4S/c1-26-14-6-4-13(5-7-14)20-16-9-8-15(27-22(25)19-3-2-10-29-19)11-18(16)28-21(24)17(20)12-23/h2-11,20H,24H2,1H3 |
| InChIKey | BEBLPAQOCDIQBM-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 94.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.45 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|