C23H18N2O5S — CID 19122410
[2-amino-3-cyano-4-(2,4-dimethoxyphenyl)-4H-chromen-7-yl] thiophene-2-carboxylate (PubChem CID 19122410) has the molecular formula C23H18N2O5S and a molecular weight of 434.47 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(2,4-dimethoxyphenyl)-4H-chromen-7-yl] thiophene-2-carboxylate.
| Compound Name | [2-amino-3-cyano-4-(2,4-dimethoxyphenyl)-4H-chromen-7-yl] thiophene-2-carboxylate |
|---|---|
| PubChem CID | 19122410 |
| Molecular Formula | C23H18N2O5S |
| Molecular Weight | 434.47 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | [2-amino-3-cyano-4-(2,4-dimethoxyphenyl)-4H-chromen-7-yl] thiophene-2-carboxylate |
| SMILES | COc1ccc(C2C(C#N)=C(N)Oc3cc(OC(=O)c4cccs4)ccc32)c(OC)c1 |
| InChI | InChI=1S/C23H18N2O5S/c1-27-13-5-7-15(18(10-13)28-2)21-16-8-6-14(29-23(26)20-4-3-9-31-20)11-19(16)30-22(25)17(21)12-24/h3-11,21H,25H2,1-2H3 |
| InChIKey | VIWJWMJIQZWUIM-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 103.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.47 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|