C26H21FN2O6 — CID 19122397
[2-amino-3-cyano-4-(2,4-dimethoxyphenyl)-4H-chromen-7-yl] 2-(4-fluorophenoxy)acetate (PubChem CID 19122397) has the molecular formula C26H21FN2O6 and a molecular weight of 476.46 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(2,4-dimethoxyphenyl)-4H-chromen-7-yl] 2-(4-fluorophenoxy)acetate.
| Compound Name | [2-amino-3-cyano-4-(2,4-dimethoxyphenyl)-4H-chromen-7-yl] 2-(4-fluorophenoxy)acetate |
|---|---|
| PubChem CID | 19122397 |
| Molecular Formula | C26H21FN2O6 |
| Molecular Weight | 476.46 g/mol |
| Exact Mass | 476.14 |
| IUPAC Name | [2-amino-3-cyano-4-(2,4-dimethoxyphenyl)-4H-chromen-7-yl] 2-(4-fluorophenoxy)acetate |
| SMILES | COc1ccc(C2C(C#N)=C(N)Oc3cc(OC(=O)COc4ccc(F)cc4)ccc32)c(OC)c1 |
| InChI | InChI=1S/C26H21FN2O6/c1-31-17-7-9-19(22(11-17)32-2)25-20-10-8-18(12-23(20)35-26(29)21(25)13-28)34-24(30)14-33-16-5-3-15(27)4-6-16/h3-12,25H,14,29H2,1-2H3 |
| InChIKey | JSJDQFZOIIWLSA-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 113.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.46 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|