C31H27ClN2O5S — CID 19128677
[2-amino-4-(4-butoxy-3-methoxyphenyl)-3-cyano-4H-chromen-7-yl] 3-chloro-6-methyl-1-benzothiophene-2-carboxylate (PubChem CID 19128677) has the molecular formula C31H27ClN2O5S and a molecular weight of 575.09 g/mol. Its IUPAC name is [2-amino-4-(4-butoxy-3-methoxyphenyl)-3-cyano-4H-chromen-7-yl] 3-chloro-6-methyl-1-benzothiophene-2-carboxylate.
| Compound Name | [2-amino-4-(4-butoxy-3-methoxyphenyl)-3-cyano-4H-chromen-7-yl] 3-chloro-6-methyl-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 19128677 |
| Molecular Formula | C31H27ClN2O5S |
| Molecular Weight | 575.09 g/mol |
| Exact Mass | 574.13 |
| IUPAC Name | [2-amino-4-(4-butoxy-3-methoxyphenyl)-3-cyano-4H-chromen-7-yl] 3-chloro-6-methyl-1-benzothiophene-2-carboxylate |
| SMILES | CCCCOc1ccc(C2C(C#N)=C(N)Oc3cc(OC(=O)c4sc5cc(C)ccc5c4Cl)ccc32)cc1OC |
| InChI | InChI=1S/C31H27ClN2O5S/c1-4-5-12-37-23-11-7-18(14-25(23)36-3)27-20-10-8-19(15-24(20)39-30(34)22(27)16-33)38-31(35)29-28(32)21-9-6-17(2)13-26(21)40-29/h6-11,13-15,27H,4-5,12,34H2,1-3H3 |
| InChIKey | OPMLTOJPOACNQF-UHFFFAOYSA-N |
| XLogP | 7.49 |
| TPSA | 103.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.09 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|