C33H29Cl3N2O5S — CID 19129232
[2-amino-3-cyano-4-(4-heptoxy-3-methoxyphenyl)-4H-chromen-7-yl] 3,4,6-trichloro-1-benzothiophene-2-carboxylate (PubChem CID 19129232) has the molecular formula C33H29Cl3N2O5S and a molecular weight of 672.03 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(4-heptoxy-3-methoxyphenyl)-4H-chromen-7-yl] 3,4,6-trichloro-1-benzothiophene-2-carboxylate.
| Compound Name | [2-amino-3-cyano-4-(4-heptoxy-3-methoxyphenyl)-4H-chromen-7-yl] 3,4,6-trichloro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 19129232 |
| Molecular Formula | C33H29Cl3N2O5S |
| Molecular Weight | 672.03 g/mol |
| Exact Mass | 670.09 |
| IUPAC Name | [2-amino-3-cyano-4-(4-heptoxy-3-methoxyphenyl)-4H-chromen-7-yl] 3,4,6-trichloro-1-benzothiophene-2-carboxylate |
| SMILES | CCCCCCCOc1ccc(C2C(C#N)=C(N)Oc3cc(OC(=O)c4sc5cc(Cl)cc(Cl)c5c4Cl)ccc32)cc1OC |
| InChI | InChI=1S/C33H29Cl3N2O5S/c1-3-4-5-6-7-12-41-24-11-8-18(13-26(24)40-2)28-21-10-9-20(16-25(21)43-32(38)22(28)17-37)42-33(39)31-30(36)29-23(35)14-19(34)15-27(29)44-31/h8-11,13-16,28H,3-7,12,38H2,1-2H3 |
| InChIKey | HKPIFRDCLCRYCK-UHFFFAOYSA-N |
| XLogP | 9.66 |
| TPSA | 103.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 672.03 |
| LogP ≤ 5 | 9.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|