C30H23Cl3N2O5S — CID 19129112
[2-amino-3-cyano-4-(3-ethoxy-4-propoxyphenyl)-4H-chromen-7-yl] 3,4,6-trichloro-1-benzothiophene-2-carboxylate (PubChem CID 19129112) has the molecular formula C30H23Cl3N2O5S and a molecular weight of 629.95 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(3-ethoxy-4-propoxyphenyl)-4H-chromen-7-yl] 3,4,6-trichloro-1-benzothiophene-2-carboxylate.
| Compound Name | [2-amino-3-cyano-4-(3-ethoxy-4-propoxyphenyl)-4H-chromen-7-yl] 3,4,6-trichloro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 19129112 |
| Molecular Formula | C30H23Cl3N2O5S |
| Molecular Weight | 629.95 g/mol |
| Exact Mass | 628.04 |
| IUPAC Name | [2-amino-3-cyano-4-(3-ethoxy-4-propoxyphenyl)-4H-chromen-7-yl] 3,4,6-trichloro-1-benzothiophene-2-carboxylate |
| SMILES | CCCOc1ccc(C2C(C#N)=C(N)Oc3cc(OC(=O)c4sc5cc(Cl)cc(Cl)c5c4Cl)ccc32)cc1OCC |
| InChI | InChI=1S/C30H23Cl3N2O5S/c1-3-9-38-21-8-5-15(10-23(21)37-4-2)25-18-7-6-17(13-22(18)40-29(35)19(25)14-34)39-30(36)28-27(33)26-20(32)11-16(31)12-24(26)41-28/h5-8,10-13,25H,3-4,9,35H2,1-2H3 |
| InChIKey | JEZWFIKCZPVYHK-UHFFFAOYSA-N |
| XLogP | 8.49 |
| TPSA | 103.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.95 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|