C30H24Cl2N2O4S — CID 19129399
[2-amino-3-cyano-4-(4-pentoxyphenyl)-4H-chromen-7-yl] 3,4-dichloro-1-benzothiophene-2-carboxylate (PubChem CID 19129399) has the molecular formula C30H24Cl2N2O4S and a molecular weight of 579.51 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(4-pentoxyphenyl)-4H-chromen-7-yl] 3,4-dichloro-1-benzothiophene-2-carboxylate.
| Compound Name | [2-amino-3-cyano-4-(4-pentoxyphenyl)-4H-chromen-7-yl] 3,4-dichloro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 19129399 |
| Molecular Formula | C30H24Cl2N2O4S |
| Molecular Weight | 579.51 g/mol |
| Exact Mass | 578.08 |
| IUPAC Name | [2-amino-3-cyano-4-(4-pentoxyphenyl)-4H-chromen-7-yl] 3,4-dichloro-1-benzothiophene-2-carboxylate |
| SMILES | CCCCCOc1ccc(C2C(C#N)=C(N)Oc3cc(OC(=O)c4sc5cccc(Cl)c5c4Cl)ccc32)cc1 |
| InChI | InChI=1S/C30H24Cl2N2O4S/c1-2-3-4-14-36-18-10-8-17(9-11-18)25-20-13-12-19(15-23(20)38-29(34)21(25)16-33)37-30(35)28-27(32)26-22(31)6-5-7-24(26)39-28/h5-13,15,25H,2-4,14,34H2,1H3 |
| InChIKey | VBWKPUQMBFEJCX-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 94.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.51 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|