C27H17Cl3N2O4S — CID 19129352
[2-amino-3-cyano-4-(3-ethoxyphenyl)-4H-chromen-7-yl] 3,4,6-trichloro-1-benzothiophene-2-carboxylate (PubChem CID 19129352) has the molecular formula C27H17Cl3N2O4S and a molecular weight of 571.87 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(3-ethoxyphenyl)-4H-chromen-7-yl] 3,4,6-trichloro-1-benzothiophene-2-carboxylate.
| Compound Name | [2-amino-3-cyano-4-(3-ethoxyphenyl)-4H-chromen-7-yl] 3,4,6-trichloro-1-benzothiophene-2-carboxylate |
|---|---|
| PubChem CID | 19129352 |
| Molecular Formula | C27H17Cl3N2O4S |
| Molecular Weight | 571.87 g/mol |
| Exact Mass | 570.00 |
| IUPAC Name | [2-amino-3-cyano-4-(3-ethoxyphenyl)-4H-chromen-7-yl] 3,4,6-trichloro-1-benzothiophene-2-carboxylate |
| SMILES | CCOc1cccc(C2C(C#N)=C(N)Oc3cc(OC(=O)c4sc5cc(Cl)cc(Cl)c5c4Cl)ccc32)c1 |
| InChI | InChI=1S/C27H17Cl3N2O4S/c1-2-34-15-5-3-4-13(8-15)22-17-7-6-16(11-20(17)36-26(32)18(22)12-31)35-27(33)25-24(30)23-19(29)9-14(28)10-21(23)37-25/h3-11,22H,2,32H2,1H3 |
| InChIKey | ZVAPVDKAAFDORE-UHFFFAOYSA-N |
| XLogP | 7.70 |
| TPSA | 94.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.87 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|