C32H30N2O6 — CID 19128684
[2-amino-4-(4-butoxy-3-methoxyphenyl)-3-cyano-4H-chromen-7-yl] 3,6-dimethyl-1-benzofuran-2-carboxylate (PubChem CID 19128684) has the molecular formula C32H30N2O6 and a molecular weight of 538.60 g/mol. Its IUPAC name is [2-amino-4-(4-butoxy-3-methoxyphenyl)-3-cyano-4H-chromen-7-yl] 3,6-dimethyl-1-benzofuran-2-carboxylate.
| Compound Name | [2-amino-4-(4-butoxy-3-methoxyphenyl)-3-cyano-4H-chromen-7-yl] 3,6-dimethyl-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 19128684 |
| Molecular Formula | C32H30N2O6 |
| Molecular Weight | 538.60 g/mol |
| Exact Mass | 538.21 |
| IUPAC Name | [2-amino-4-(4-butoxy-3-methoxyphenyl)-3-cyano-4H-chromen-7-yl] 3,6-dimethyl-1-benzofuran-2-carboxylate |
| SMILES | CCCCOc1ccc(C2C(C#N)=C(N)Oc3cc(OC(=O)c4oc5cc(C)ccc5c4C)ccc32)cc1OC |
| InChI | InChI=1S/C32H30N2O6/c1-5-6-13-37-25-12-8-20(15-28(25)36-4)29-23-11-9-21(16-27(23)40-31(34)24(29)17-33)38-32(35)30-19(3)22-10-7-18(2)14-26(22)39-30/h7-12,14-16,29H,5-6,13,34H2,1-4H3 |
| InChIKey | QSQZMBBBGVHQRG-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 116.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.60 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|