C32H29BrN2O6 — CID 19129146
[2-amino-4-(4-butoxy-3-ethoxyphenyl)-3-cyano-4H-chromen-7-yl] 5-bromo-3-methyl-1-benzofuran-2-carboxylate (PubChem CID 19129146) has the molecular formula C32H29BrN2O6 and a molecular weight of 617.50 g/mol. Its IUPAC name is [2-amino-4-(4-butoxy-3-ethoxyphenyl)-3-cyano-4H-chromen-7-yl] 5-bromo-3-methyl-1-benzofuran-2-carboxylate.
| Compound Name | [2-amino-4-(4-butoxy-3-ethoxyphenyl)-3-cyano-4H-chromen-7-yl] 5-bromo-3-methyl-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 19129146 |
| Molecular Formula | C32H29BrN2O6 |
| Molecular Weight | 617.50 g/mol |
| Exact Mass | 616.12 |
| IUPAC Name | [2-amino-4-(4-butoxy-3-ethoxyphenyl)-3-cyano-4H-chromen-7-yl] 5-bromo-3-methyl-1-benzofuran-2-carboxylate |
| SMILES | CCCCOc1ccc(C2C(C#N)=C(N)Oc3cc(OC(=O)c4oc5ccc(Br)cc5c4C)ccc32)cc1OCC |
| InChI | InChI=1S/C32H29BrN2O6/c1-4-6-13-38-26-11-7-19(14-28(26)37-5-2)29-22-10-9-21(16-27(22)41-31(35)24(29)17-34)39-32(36)30-18(3)23-15-20(33)8-12-25(23)40-30/h7-12,14-16,29H,4-6,13,35H2,1-3H3 |
| InChIKey | HLMFYVAMIRRAQB-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 116.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.50 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|