C35H36N2O6 — CID 19129251
[2-amino-3-cyano-4-(4-heptoxy-3-methoxyphenyl)-4H-chromen-7-yl] 3,5-dimethyl-1-benzofuran-2-carboxylate (PubChem CID 19129251) has the molecular formula C35H36N2O6 and a molecular weight of 580.68 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(4-heptoxy-3-methoxyphenyl)-4H-chromen-7-yl] 3,5-dimethyl-1-benzofuran-2-carboxylate.
| Compound Name | [2-amino-3-cyano-4-(4-heptoxy-3-methoxyphenyl)-4H-chromen-7-yl] 3,5-dimethyl-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 19129251 |
| Molecular Formula | C35H36N2O6 |
| Molecular Weight | 580.68 g/mol |
| Exact Mass | 580.26 |
| IUPAC Name | [2-amino-3-cyano-4-(4-heptoxy-3-methoxyphenyl)-4H-chromen-7-yl] 3,5-dimethyl-1-benzofuran-2-carboxylate |
| SMILES | CCCCCCCOc1ccc(C2C(C#N)=C(N)Oc3cc(OC(=O)c4oc5ccc(C)cc5c4C)ccc32)cc1OC |
| InChI | InChI=1S/C35H36N2O6/c1-5-6-7-8-9-16-40-29-15-11-23(18-31(29)39-4)32-25-13-12-24(19-30(25)43-34(37)27(32)20-36)41-35(38)33-22(3)26-17-21(2)10-14-28(26)42-33/h10-15,17-19,32H,5-9,16,37H2,1-4H3 |
| InChIKey | PDEHDFCVCUOQFZ-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 116.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.68 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|