C29H23BrN2O6 — CID 19128618
[2-amino-3-cyano-4-(4-ethoxy-3-methoxyphenyl)-4H-chromen-7-yl] 5-bromo-3-methyl-1-benzofuran-2-carboxylate (PubChem CID 19128618) has the molecular formula C29H23BrN2O6 and a molecular weight of 575.42 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(4-ethoxy-3-methoxyphenyl)-4H-chromen-7-yl] 5-bromo-3-methyl-1-benzofuran-2-carboxylate.
| Compound Name | [2-amino-3-cyano-4-(4-ethoxy-3-methoxyphenyl)-4H-chromen-7-yl] 5-bromo-3-methyl-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 19128618 |
| Molecular Formula | C29H23BrN2O6 |
| Molecular Weight | 575.42 g/mol |
| Exact Mass | 574.07 |
| IUPAC Name | [2-amino-3-cyano-4-(4-ethoxy-3-methoxyphenyl)-4H-chromen-7-yl] 5-bromo-3-methyl-1-benzofuran-2-carboxylate |
| SMILES | CCOc1ccc(C2C(C#N)=C(N)Oc3cc(OC(=O)c4oc5ccc(Br)cc5c4C)ccc32)cc1OC |
| InChI | InChI=1S/C29H23BrN2O6/c1-4-35-23-9-5-16(11-25(23)34-3)26-19-8-7-18(13-24(19)38-28(32)21(26)14-31)36-29(33)27-15(2)20-12-17(30)6-10-22(20)37-27/h5-13,26H,4,32H2,1-3H3 |
| InChIKey | ZDCIKXRHKRRMOL-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 116.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.42 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|