C29H23BrN2O5 — CID 19128090
[2-amino-3-cyano-4-(4-propoxyphenyl)-4H-chromen-7-yl] 5-bromo-3-methyl-1-benzofuran-2-carboxylate (PubChem CID 19128090) has the molecular formula C29H23BrN2O5 and a molecular weight of 559.42 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(4-propoxyphenyl)-4H-chromen-7-yl] 5-bromo-3-methyl-1-benzofuran-2-carboxylate.
| Compound Name | [2-amino-3-cyano-4-(4-propoxyphenyl)-4H-chromen-7-yl] 5-bromo-3-methyl-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 19128090 |
| Molecular Formula | C29H23BrN2O5 |
| Molecular Weight | 559.42 g/mol |
| Exact Mass | 558.08 |
| IUPAC Name | [2-amino-3-cyano-4-(4-propoxyphenyl)-4H-chromen-7-yl] 5-bromo-3-methyl-1-benzofuran-2-carboxylate |
| SMILES | CCCOc1ccc(C2C(C#N)=C(N)Oc3cc(OC(=O)c4oc5ccc(Br)cc5c4C)ccc32)cc1 |
| InChI | InChI=1S/C29H23BrN2O5/c1-3-12-34-19-7-4-17(5-8-19)26-21-10-9-20(14-25(21)37-28(32)23(26)15-31)35-29(33)27-16(2)22-13-18(30)6-11-24(22)36-27/h4-11,13-14,26H,3,12,32H2,1-2H3 |
| InChIKey | FIFUQJRJYMGNJQ-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 107.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.42 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|