C26H16BrFN2O4 — CID 19128237
[2-amino-4-(3-bromophenyl)-3-cyano-4H-chromen-7-yl] 5-fluoro-3-methyl-1-benzofuran-2-carboxylate (PubChem CID 19128237) has the molecular formula C26H16BrFN2O4 and a molecular weight of 519.33 g/mol. Its IUPAC name is [2-amino-4-(3-bromophenyl)-3-cyano-4H-chromen-7-yl] 5-fluoro-3-methyl-1-benzofuran-2-carboxylate.
| Compound Name | [2-amino-4-(3-bromophenyl)-3-cyano-4H-chromen-7-yl] 5-fluoro-3-methyl-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 19128237 |
| Molecular Formula | C26H16BrFN2O4 |
| Molecular Weight | 519.33 g/mol |
| Exact Mass | 518.03 |
| IUPAC Name | [2-amino-4-(3-bromophenyl)-3-cyano-4H-chromen-7-yl] 5-fluoro-3-methyl-1-benzofuran-2-carboxylate |
| SMILES | Cc1c(C(=O)Oc2ccc3c(c2)OC(N)=C(C#N)C3c2cccc(Br)c2)oc2ccc(F)cc12 |
| InChI | InChI=1S/C26H16BrFN2O4/c1-13-19-10-16(28)5-8-21(19)33-24(13)26(31)32-17-6-7-18-22(11-17)34-25(30)20(12-29)23(18)14-3-2-4-15(27)9-14/h2-11,23H,30H2,1H3 |
| InChIKey | JTZKMYPORXTCPQ-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 98.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.33 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|