C28H21BrN2O6 — CID 19128578
[2-amino-3-cyano-4-(2,3-dimethoxyphenyl)-4H-chromen-7-yl] 6-bromo-3-methyl-1-benzofuran-2-carboxylate (PubChem CID 19128578) has the molecular formula C28H21BrN2O6 and a molecular weight of 561.39 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(2,3-dimethoxyphenyl)-4H-chromen-7-yl] 6-bromo-3-methyl-1-benzofuran-2-carboxylate.
| Compound Name | [2-amino-3-cyano-4-(2,3-dimethoxyphenyl)-4H-chromen-7-yl] 6-bromo-3-methyl-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 19128578 |
| Molecular Formula | C28H21BrN2O6 |
| Molecular Weight | 561.39 g/mol |
| Exact Mass | 560.06 |
| IUPAC Name | [2-amino-3-cyano-4-(2,3-dimethoxyphenyl)-4H-chromen-7-yl] 6-bromo-3-methyl-1-benzofuran-2-carboxylate |
| SMILES | COc1cccc(C2C(C#N)=C(N)Oc3cc(OC(=O)c4oc5cc(Br)ccc5c4C)ccc32)c1OC |
| InChI | InChI=1S/C28H21BrN2O6/c1-14-17-9-7-15(29)11-22(17)36-25(14)28(32)35-16-8-10-18-23(12-16)37-27(31)20(13-30)24(18)19-5-4-6-21(33-2)26(19)34-3/h4-12,24H,31H2,1-3H3 |
| InChIKey | QCQOMNAKINIVGH-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 116.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.39 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|