C32H24N2O4 — CID 19128493
(2-amino-3-cyano-4-naphthalen-1-yl-4H-chromen-7-yl) 3,5,6-trimethyl-1-benzofuran-2-carboxylate (PubChem CID 19128493) has the molecular formula C32H24N2O4 and a molecular weight of 500.55 g/mol. Its IUPAC name is (2-amino-3-cyano-4-naphthalen-1-yl-4H-chromen-7-yl) 3,5,6-trimethyl-1-benzofuran-2-carboxylate.
| Compound Name | (2-amino-3-cyano-4-naphthalen-1-yl-4H-chromen-7-yl) 3,5,6-trimethyl-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 19128493 |
| Molecular Formula | C32H24N2O4 |
| Molecular Weight | 500.55 g/mol |
| Exact Mass | 500.17 |
| IUPAC Name | (2-amino-3-cyano-4-naphthalen-1-yl-4H-chromen-7-yl) 3,5,6-trimethyl-1-benzofuran-2-carboxylate |
| SMILES | Cc1cc2oc(C(=O)Oc3ccc4c(c3)OC(N)=C(C#N)C4c3cccc4ccccc34)c(C)c2cc1C |
| InChI | InChI=1S/C32H24N2O4/c1-17-13-25-19(3)30(37-27(25)14-18(17)2)32(35)36-21-11-12-24-28(15-21)38-31(34)26(16-33)29(24)23-10-6-8-20-7-4-5-9-22(20)23/h4-15,29H,34H2,1-3H3 |
| InChIKey | DSRDXWJLAWSUTK-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 98.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.55 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|