C27H18ClFN2O4 — CID 19128284
[2-amino-3-cyano-4-(2-fluorophenyl)-4H-chromen-7-yl] 5-chloro-3,6-dimethyl-1-benzofuran-2-carboxylate (PubChem CID 19128284) has the molecular formula C27H18ClFN2O4 and a molecular weight of 488.90 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(2-fluorophenyl)-4H-chromen-7-yl] 5-chloro-3,6-dimethyl-1-benzofuran-2-carboxylate.
| Compound Name | [2-amino-3-cyano-4-(2-fluorophenyl)-4H-chromen-7-yl] 5-chloro-3,6-dimethyl-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 19128284 |
| Molecular Formula | C27H18ClFN2O4 |
| Molecular Weight | 488.90 g/mol |
| Exact Mass | 488.09 |
| IUPAC Name | [2-amino-3-cyano-4-(2-fluorophenyl)-4H-chromen-7-yl] 5-chloro-3,6-dimethyl-1-benzofuran-2-carboxylate |
| SMILES | Cc1cc2oc(C(=O)Oc3ccc4c(c3)OC(N)=C(C#N)C4c3ccccc3F)c(C)c2cc1Cl |
| InChI | InChI=1S/C27H18ClFN2O4/c1-13-9-22-18(11-20(13)28)14(2)25(34-22)27(32)33-15-7-8-17-23(10-15)35-26(31)19(12-30)24(17)16-5-3-4-6-21(16)29/h3-11,24H,31H2,1-2H3 |
| InChIKey | OGECMANAHOATLR-UHFFFAOYSA-N |
| XLogP | 6.28 |
| TPSA | 98.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.90 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|