C26H15FN2O5 — CID 19128273
[2-amino-3-cyano-4-(2-fluorophenyl)-4H-chromen-7-yl] 2-oxochromene-3-carboxylate (PubChem CID 19128273) has the molecular formula C26H15FN2O5 and a molecular weight of 454.41 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(2-fluorophenyl)-4H-chromen-7-yl] 2-oxochromene-3-carboxylate.
| Compound Name | [2-amino-3-cyano-4-(2-fluorophenyl)-4H-chromen-7-yl] 2-oxochromene-3-carboxylate |
|---|---|
| PubChem CID | 19128273 |
| Molecular Formula | C26H15FN2O5 |
| Molecular Weight | 454.41 g/mol |
| Exact Mass | 454.10 |
| IUPAC Name | [2-amino-3-cyano-4-(2-fluorophenyl)-4H-chromen-7-yl] 2-oxochromene-3-carboxylate |
| SMILES | N#CC1=C(N)Oc2cc(OC(=O)c3cc4ccccc4oc3=O)ccc2C1c1ccccc1F |
| InChI | InChI=1S/C26H15FN2O5/c27-20-7-3-2-6-16(20)23-17-10-9-15(12-22(17)33-24(29)19(23)13-28)32-25(30)18-11-14-5-1-4-8-21(14)34-26(18)31/h1-12,23H,29H2 |
| InChIKey | JMKFPRKVBBCKOC-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 115.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.41 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|