C34H23ClN2O7 — CID 19129833
[2-amino-4-[4-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]-3-cyano-4H-chromen-7-yl] 2-oxochromene-3-carboxylate (PubChem CID 19129833) has the molecular formula C34H23ClN2O7 and a molecular weight of 607.02 g/mol. Its IUPAC name is [2-amino-4-[4-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]-3-cyano-4H-chromen-7-yl] 2-oxochromene-3-carboxylate.
| Compound Name | [2-amino-4-[4-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]-3-cyano-4H-chromen-7-yl] 2-oxochromene-3-carboxylate |
|---|---|
| PubChem CID | 19129833 |
| Molecular Formula | C34H23ClN2O7 |
| Molecular Weight | 607.02 g/mol |
| Exact Mass | 606.12 |
| IUPAC Name | [2-amino-4-[4-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]-3-cyano-4H-chromen-7-yl] 2-oxochromene-3-carboxylate |
| SMILES | COc1cc(C2C(C#N)=C(N)Oc3cc(OC(=O)c4cc5ccccc5oc4=O)ccc32)ccc1OCc1ccccc1Cl |
| InChI | InChI=1S/C34H23ClN2O7/c1-40-30-15-20(10-13-28(30)41-18-21-7-2-4-8-26(21)35)31-23-12-11-22(16-29(23)43-32(37)25(31)17-36)42-33(38)24-14-19-6-3-5-9-27(19)44-34(24)39/h2-16,31H,18,37H2,1H3 |
| InChIKey | KCSNOQJMTWECSI-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 134.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.02 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|