C35H25ClN2O5 — CID 19127066
[2-amino-4-[4-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]-3-cyano-4H-chromen-7-yl] naphthalene-1-carboxylate (PubChem CID 19127066) has the molecular formula C35H25ClN2O5 and a molecular weight of 589.05 g/mol. Its IUPAC name is [2-amino-4-[4-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]-3-cyano-4H-chromen-7-yl] naphthalene-1-carboxylate.
| Compound Name | [2-amino-4-[4-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]-3-cyano-4H-chromen-7-yl] naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 19127066 |
| Molecular Formula | C35H25ClN2O5 |
| Molecular Weight | 589.05 g/mol |
| Exact Mass | 588.15 |
| IUPAC Name | [2-amino-4-[4-[(2-chlorophenyl)methoxy]-3-methoxyphenyl]-3-cyano-4H-chromen-7-yl] naphthalene-1-carboxylate |
| SMILES | COc1cc(C2C(C#N)=C(N)Oc3cc(OC(=O)c4cccc5ccccc45)ccc32)ccc1OCc1ccccc1Cl |
| InChI | InChI=1S/C35H25ClN2O5/c1-40-32-17-22(13-16-30(32)41-20-23-8-3-5-12-29(23)36)33-27-15-14-24(18-31(27)43-34(38)28(33)19-37)42-35(39)26-11-6-9-21-7-2-4-10-25(21)26/h2-18,33H,20,38H2,1H3 |
| InChIKey | OVJLXNYHIGCNCB-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 103.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.05 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|