C29H22N2O7 — CID 19128609
[2-amino-3-cyano-4-(4-ethoxy-3-methoxyphenyl)-4H-chromen-7-yl] 2-oxochromene-3-carboxylate (PubChem CID 19128609) has the molecular formula C29H22N2O7 and a molecular weight of 510.50 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(4-ethoxy-3-methoxyphenyl)-4H-chromen-7-yl] 2-oxochromene-3-carboxylate.
| Compound Name | [2-amino-3-cyano-4-(4-ethoxy-3-methoxyphenyl)-4H-chromen-7-yl] 2-oxochromene-3-carboxylate |
|---|---|
| PubChem CID | 19128609 |
| Molecular Formula | C29H22N2O7 |
| Molecular Weight | 510.50 g/mol |
| Exact Mass | 510.14 |
| IUPAC Name | [2-amino-3-cyano-4-(4-ethoxy-3-methoxyphenyl)-4H-chromen-7-yl] 2-oxochromene-3-carboxylate |
| SMILES | CCOc1ccc(C2C(C#N)=C(N)Oc3cc(OC(=O)c4cc5ccccc5oc4=O)ccc32)cc1OC |
| InChI | InChI=1S/C29H22N2O7/c1-3-35-23-11-8-17(13-25(23)34-2)26-19-10-9-18(14-24(19)37-27(31)21(26)15-30)36-28(32)20-12-16-6-4-5-7-22(16)38-29(20)33/h4-14,26H,3,31H2,1-2H3 |
| InChIKey | CWDAWZSIMWNNIM-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 134.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.50 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|