C25H17FN2O5 — CID 19128597
[2-amino-3-cyano-4-(5-methylfuran-2-yl)-4H-chromen-7-yl] 5-fluoro-3-methyl-1-benzofuran-2-carboxylate (PubChem CID 19128597) has the molecular formula C25H17FN2O5 and a molecular weight of 444.42 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(5-methylfuran-2-yl)-4H-chromen-7-yl] 5-fluoro-3-methyl-1-benzofuran-2-carboxylate.
| Compound Name | [2-amino-3-cyano-4-(5-methylfuran-2-yl)-4H-chromen-7-yl] 5-fluoro-3-methyl-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 19128597 |
| Molecular Formula | C25H17FN2O5 |
| Molecular Weight | 444.42 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | [2-amino-3-cyano-4-(5-methylfuran-2-yl)-4H-chromen-7-yl] 5-fluoro-3-methyl-1-benzofuran-2-carboxylate |
| SMILES | Cc1ccc(C2C(C#N)=C(N)Oc3cc(OC(=O)c4oc5ccc(F)cc5c4C)ccc32)o1 |
| InChI | InChI=1S/C25H17FN2O5/c1-12-3-7-20(30-12)22-16-6-5-15(10-21(16)33-24(28)18(22)11-27)31-25(29)23-13(2)17-9-14(26)4-8-19(17)32-23/h3-10,22H,28H2,1-2H3 |
| InChIKey | DFNTZEYVKMXYKT-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 111.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.42 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|