C31H27FN2O5 — CID 19129317
[2-amino-3-cyano-4-[3-(3-methylbutoxy)phenyl]-4H-chromen-7-yl] 5-fluoro-3-methyl-1-benzofuran-2-carboxylate (PubChem CID 19129317) has the molecular formula C31H27FN2O5 and a molecular weight of 526.56 g/mol. Its IUPAC name is [2-amino-3-cyano-4-[3-(3-methylbutoxy)phenyl]-4H-chromen-7-yl] 5-fluoro-3-methyl-1-benzofuran-2-carboxylate.
| Compound Name | [2-amino-3-cyano-4-[3-(3-methylbutoxy)phenyl]-4H-chromen-7-yl] 5-fluoro-3-methyl-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 19129317 |
| Molecular Formula | C31H27FN2O5 |
| Molecular Weight | 526.56 g/mol |
| Exact Mass | 526.19 |
| IUPAC Name | [2-amino-3-cyano-4-[3-(3-methylbutoxy)phenyl]-4H-chromen-7-yl] 5-fluoro-3-methyl-1-benzofuran-2-carboxylate |
| SMILES | Cc1c(C(=O)Oc2ccc3c(c2)OC(N)=C(C#N)C3c2cccc(OCCC(C)C)c2)oc2ccc(F)cc12 |
| InChI | InChI=1S/C31H27FN2O5/c1-17(2)11-12-36-21-6-4-5-19(13-21)28-23-9-8-22(15-27(23)39-30(34)25(28)16-33)37-31(35)29-18(3)24-14-20(32)7-10-26(24)38-29/h4-10,13-15,17,28H,11-12,34H2,1-3H3 |
| InChIKey | YRBDZVKJIKAWRN-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 107.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.56 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|