C28H25N3O6 — CID 19125294
[2-amino-3-cyano-4-[3-(3-methylbutoxy)phenyl]-4H-chromen-7-yl] 2-nitrobenzoate (PubChem CID 19125294) has the molecular formula C28H25N3O6 and a molecular weight of 499.52 g/mol. Its IUPAC name is [2-amino-3-cyano-4-[3-(3-methylbutoxy)phenyl]-4H-chromen-7-yl] 2-nitrobenzoate.
| Compound Name | [2-amino-3-cyano-4-[3-(3-methylbutoxy)phenyl]-4H-chromen-7-yl] 2-nitrobenzoate |
|---|---|
| PubChem CID | 19125294 |
| Molecular Formula | C28H25N3O6 |
| Molecular Weight | 499.52 g/mol |
| Exact Mass | 499.17 |
| IUPAC Name | [2-amino-3-cyano-4-[3-(3-methylbutoxy)phenyl]-4H-chromen-7-yl] 2-nitrobenzoate |
| SMILES | CC(C)CCOc1cccc(C2C(C#N)=C(N)Oc3cc(OC(=O)c4ccccc4[N+](=O)[O-])ccc32)c1 |
| InChI | InChI=1S/C28H25N3O6/c1-17(2)12-13-35-19-7-5-6-18(14-19)26-22-11-10-20(15-25(22)37-27(30)23(26)16-29)36-28(32)21-8-3-4-9-24(21)31(33)34/h3-11,14-15,17,26H,12-13,30H2,1-2H3 |
| InChIKey | RGCJWEYPASFGTD-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 137.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.52 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|