C31H30N2O4 — CID 19125282
[2-amino-3-cyano-4-[3-(3-methylbutoxy)phenyl]-4H-chromen-7-yl] (E)-3-(4-methylphenyl)prop-2-enoate (PubChem CID 19125282) has the molecular formula C31H30N2O4 and a molecular weight of 494.59 g/mol. Its IUPAC name is [2-amino-3-cyano-4-[3-(3-methylbutoxy)phenyl]-4H-chromen-7-yl] (E)-3-(4-methylphenyl)prop-2-enoate.
| Compound Name | [2-amino-3-cyano-4-[3-(3-methylbutoxy)phenyl]-4H-chromen-7-yl] (E)-3-(4-methylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 19125282 |
| Molecular Formula | C31H30N2O4 |
| Molecular Weight | 494.59 g/mol |
| Exact Mass | 494.22 |
| IUPAC Name | [2-amino-3-cyano-4-[3-(3-methylbutoxy)phenyl]-4H-chromen-7-yl] (E)-3-(4-methylphenyl)prop-2-enoate |
| SMILES | Cc1ccc(/C=C/C(=O)Oc2ccc3c(c2)OC(N)=C(C#N)C3c2cccc(OCCC(C)C)c2)cc1 |
| InChI | InChI=1S/C31H30N2O4/c1-20(2)15-16-35-24-6-4-5-23(17-24)30-26-13-12-25(18-28(26)37-31(33)27(30)19-32)36-29(34)14-11-22-9-7-21(3)8-10-22/h4-14,17-18,20,30H,15-16,33H2,1-3H3/b14-11+ |
| InChIKey | OINBNXRUGNHYJT-SDNWHVSQSA-N |
| XLogP | 6.26 |
| TPSA | 94.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.59 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|