C33H34N2O6 — CID 19124971
[2-amino-3-cyano-4-[3-ethoxy-4-(3-methylbutoxy)phenyl]-4H-chromen-7-yl] (E)-3-(4-methoxyphenyl)prop-2-enoate (PubChem CID 19124971) has the molecular formula C33H34N2O6 and a molecular weight of 554.64 g/mol. Its IUPAC name is [2-amino-3-cyano-4-[3-ethoxy-4-(3-methylbutoxy)phenyl]-4H-chromen-7-yl] (E)-3-(4-methoxyphenyl)prop-2-enoate.
| Compound Name | [2-amino-3-cyano-4-[3-ethoxy-4-(3-methylbutoxy)phenyl]-4H-chromen-7-yl] (E)-3-(4-methoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 19124971 |
| Molecular Formula | C33H34N2O6 |
| Molecular Weight | 554.64 g/mol |
| Exact Mass | 554.24 |
| IUPAC Name | [2-amino-3-cyano-4-[3-ethoxy-4-(3-methylbutoxy)phenyl]-4H-chromen-7-yl] (E)-3-(4-methoxyphenyl)prop-2-enoate |
| SMILES | CCOc1cc(C2C(C#N)=C(N)Oc3cc(OC(=O)/C=C/c4ccc(OC)cc4)ccc32)ccc1OCCC(C)C |
| InChI | InChI=1S/C33H34N2O6/c1-5-38-30-18-23(9-14-28(30)39-17-16-21(2)3)32-26-13-12-25(19-29(26)41-33(35)27(32)20-34)40-31(36)15-8-22-6-10-24(37-4)11-7-22/h6-15,18-19,21,32H,5,16-17,35H2,1-4H3/b15-8+ |
| InChIKey | XQIRYJSGNMKHKZ-OVCLIPMQSA-N |
| XLogP | 6.36 |
| TPSA | 113.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.64 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|