C31H29ClN2O5 — CID 19123362
[2-amino-3-cyano-4-[3-methoxy-4-(3-methylbutoxy)phenyl]-4H-chromen-7-yl] (E)-3-(4-chlorophenyl)prop-2-enoate (PubChem CID 19123362) has the molecular formula C31H29ClN2O5 and a molecular weight of 545.04 g/mol. Its IUPAC name is [2-amino-3-cyano-4-[3-methoxy-4-(3-methylbutoxy)phenyl]-4H-chromen-7-yl] (E)-3-(4-chlorophenyl)prop-2-enoate.
| Compound Name | [2-amino-3-cyano-4-[3-methoxy-4-(3-methylbutoxy)phenyl]-4H-chromen-7-yl] (E)-3-(4-chlorophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 19123362 |
| Molecular Formula | C31H29ClN2O5 |
| Molecular Weight | 545.04 g/mol |
| Exact Mass | 544.18 |
| IUPAC Name | [2-amino-3-cyano-4-[3-methoxy-4-(3-methylbutoxy)phenyl]-4H-chromen-7-yl] (E)-3-(4-chlorophenyl)prop-2-enoate |
| SMILES | COc1cc(C2C(C#N)=C(N)Oc3cc(OC(=O)/C=C/c4ccc(Cl)cc4)ccc32)ccc1OCCC(C)C |
| InChI | InChI=1S/C31H29ClN2O5/c1-19(2)14-15-37-26-12-7-21(16-28(26)36-3)30-24-11-10-23(17-27(24)39-31(34)25(30)18-33)38-29(35)13-6-20-4-8-22(32)9-5-20/h4-13,16-17,19,30H,14-15,34H2,1-3H3/b13-6+ |
| InChIKey | ADXXYKKPGIRLDS-AWNIVKPZSA-N |
| XLogP | 6.61 |
| TPSA | 103.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.04 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|