C33H36N2O5 — CID 19123344
[2-amino-3-cyano-4-[3-methoxy-4-(3-methylbutoxy)phenyl]-4H-chromen-7-yl] 4-tert-butylbenzoate (PubChem CID 19123344) has the molecular formula C33H36N2O5 and a molecular weight of 540.66 g/mol. Its IUPAC name is [2-amino-3-cyano-4-[3-methoxy-4-(3-methylbutoxy)phenyl]-4H-chromen-7-yl] 4-tert-butylbenzoate.
| Compound Name | [2-amino-3-cyano-4-[3-methoxy-4-(3-methylbutoxy)phenyl]-4H-chromen-7-yl] 4-tert-butylbenzoate |
|---|---|
| PubChem CID | 19123344 |
| Molecular Formula | C33H36N2O5 |
| Molecular Weight | 540.66 g/mol |
| Exact Mass | 540.26 |
| IUPAC Name | [2-amino-3-cyano-4-[3-methoxy-4-(3-methylbutoxy)phenyl]-4H-chromen-7-yl] 4-tert-butylbenzoate |
| SMILES | COc1cc(C2C(C#N)=C(N)Oc3cc(OC(=O)c4ccc(C(C)(C)C)cc4)ccc32)ccc1OCCC(C)C |
| InChI | InChI=1S/C33H36N2O5/c1-20(2)15-16-38-27-14-9-22(17-29(27)37-6)30-25-13-12-24(18-28(25)40-31(35)26(30)19-34)39-32(36)21-7-10-23(11-8-21)33(3,4)5/h7-14,17-18,20,30H,15-16,35H2,1-6H3 |
| InChIKey | MMOZQAGQQSMIQX-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 103.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.66 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|