C26H24N2O5 — CID 19125289
[2-amino-3-cyano-4-[3-(3-methylbutoxy)phenyl]-4H-chromen-7-yl] furan-2-carboxylate (PubChem CID 19125289) has the molecular formula C26H24N2O5 and a molecular weight of 444.49 g/mol. Its IUPAC name is [2-amino-3-cyano-4-[3-(3-methylbutoxy)phenyl]-4H-chromen-7-yl] furan-2-carboxylate.
| Compound Name | [2-amino-3-cyano-4-[3-(3-methylbutoxy)phenyl]-4H-chromen-7-yl] furan-2-carboxylate |
|---|---|
| PubChem CID | 19125289 |
| Molecular Formula | C26H24N2O5 |
| Molecular Weight | 444.49 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | [2-amino-3-cyano-4-[3-(3-methylbutoxy)phenyl]-4H-chromen-7-yl] furan-2-carboxylate |
| SMILES | CC(C)CCOc1cccc(C2C(C#N)=C(N)Oc3cc(OC(=O)c4ccco4)ccc32)c1 |
| InChI | InChI=1S/C26H24N2O5/c1-16(2)10-12-30-18-6-3-5-17(13-18)24-20-9-8-19(32-26(29)22-7-4-11-31-22)14-23(20)33-25(28)21(24)15-27/h3-9,11,13-14,16,24H,10,12,28H2,1-2H3 |
| InChIKey | UKAIOCVWCNFBNS-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 107.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.49 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|