C29H24N2O5 — CID 19127999
[2-amino-3-cyano-4-(2-methoxyphenyl)-4H-chromen-7-yl] 3,6,7-trimethyl-1-benzofuran-2-carboxylate (PubChem CID 19127999) has the molecular formula C29H24N2O5 and a molecular weight of 480.52 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(2-methoxyphenyl)-4H-chromen-7-yl] 3,6,7-trimethyl-1-benzofuran-2-carboxylate.
| Compound Name | [2-amino-3-cyano-4-(2-methoxyphenyl)-4H-chromen-7-yl] 3,6,7-trimethyl-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 19127999 |
| Molecular Formula | C29H24N2O5 |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.17 |
| IUPAC Name | [2-amino-3-cyano-4-(2-methoxyphenyl)-4H-chromen-7-yl] 3,6,7-trimethyl-1-benzofuran-2-carboxylate |
| SMILES | COc1ccccc1C1C(C#N)=C(N)Oc2cc(OC(=O)c3oc4c(C)c(C)ccc4c3C)ccc21 |
| InChI | InChI=1S/C29H24N2O5/c1-15-9-11-19-17(3)27(36-26(19)16(15)2)29(32)34-18-10-12-21-24(13-18)35-28(31)22(14-30)25(21)20-7-5-6-8-23(20)33-4/h5-13,25H,31H2,1-4H3 |
| InChIKey | OMUZJHCMLRCGQY-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 107.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|