C32H30N2O5 — CID 19129491
[2-amino-3-cyano-4-(2-pentoxyphenyl)-4H-chromen-7-yl] 3,5-dimethyl-1-benzofuran-2-carboxylate (PubChem CID 19129491) has the molecular formula C32H30N2O5 and a molecular weight of 522.60 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(2-pentoxyphenyl)-4H-chromen-7-yl] 3,5-dimethyl-1-benzofuran-2-carboxylate.
| Compound Name | [2-amino-3-cyano-4-(2-pentoxyphenyl)-4H-chromen-7-yl] 3,5-dimethyl-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 19129491 |
| Molecular Formula | C32H30N2O5 |
| Molecular Weight | 522.60 g/mol |
| Exact Mass | 522.22 |
| IUPAC Name | [2-amino-3-cyano-4-(2-pentoxyphenyl)-4H-chromen-7-yl] 3,5-dimethyl-1-benzofuran-2-carboxylate |
| SMILES | CCCCCOc1ccccc1C1C(C#N)=C(N)Oc2cc(OC(=O)c3oc4ccc(C)cc4c3C)ccc21 |
| InChI | InChI=1S/C32H30N2O5/c1-4-5-8-15-36-26-10-7-6-9-22(26)29-23-13-12-21(17-28(23)39-31(34)25(29)18-33)37-32(35)30-20(3)24-16-19(2)11-14-27(24)38-30/h6-7,9-14,16-17,29H,4-5,8,15,34H2,1-3H3 |
| InChIKey | VOXYMMLEDQKABN-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 107.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.60 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|