C30H24N2O4 — CID 19122597
(2-amino-3-cyano-4-naphthalen-1-yl-4H-chromen-7-yl) 2-(3,4-dimethylphenoxy)acetate (PubChem CID 19122597) has the molecular formula C30H24N2O4 and a molecular weight of 476.53 g/mol. Its IUPAC name is (2-amino-3-cyano-4-naphthalen-1-yl-4H-chromen-7-yl) 2-(3,4-dimethylphenoxy)acetate.
| Compound Name | (2-amino-3-cyano-4-naphthalen-1-yl-4H-chromen-7-yl) 2-(3,4-dimethylphenoxy)acetate |
|---|---|
| PubChem CID | 19122597 |
| Molecular Formula | C30H24N2O4 |
| Molecular Weight | 476.53 g/mol |
| Exact Mass | 476.17 |
| IUPAC Name | (2-amino-3-cyano-4-naphthalen-1-yl-4H-chromen-7-yl) 2-(3,4-dimethylphenoxy)acetate |
| SMILES | Cc1ccc(OCC(=O)Oc2ccc3c(c2)OC(N)=C(C#N)C3c2cccc3ccccc23)cc1C |
| InChI | InChI=1S/C30H24N2O4/c1-18-10-11-21(14-19(18)2)34-17-28(33)35-22-12-13-25-27(15-22)36-30(32)26(16-31)29(25)24-9-5-7-20-6-3-4-8-23(20)24/h3-15,29H,17,32H2,1-2H3 |
| InChIKey | YRVPTIADXWUJLW-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 94.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.53 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|