C31H28N2O5 — CID 19128094
[2-amino-3-cyano-4-(4-propoxyphenyl)-4H-chromen-7-yl] 3,4,6-trimethyl-1-benzofuran-2-carboxylate (PubChem CID 19128094) has the molecular formula C31H28N2O5 and a molecular weight of 508.57 g/mol. Its IUPAC name is [2-amino-3-cyano-4-(4-propoxyphenyl)-4H-chromen-7-yl] 3,4,6-trimethyl-1-benzofuran-2-carboxylate.
| Compound Name | [2-amino-3-cyano-4-(4-propoxyphenyl)-4H-chromen-7-yl] 3,4,6-trimethyl-1-benzofuran-2-carboxylate |
|---|---|
| PubChem CID | 19128094 |
| Molecular Formula | C31H28N2O5 |
| Molecular Weight | 508.57 g/mol |
| Exact Mass | 508.20 |
| IUPAC Name | [2-amino-3-cyano-4-(4-propoxyphenyl)-4H-chromen-7-yl] 3,4,6-trimethyl-1-benzofuran-2-carboxylate |
| SMILES | CCCOc1ccc(C2C(C#N)=C(N)Oc3cc(OC(=O)c4oc5cc(C)cc(C)c5c4C)ccc32)cc1 |
| InChI | InChI=1S/C31H28N2O5/c1-5-12-35-21-8-6-20(7-9-21)28-23-11-10-22(15-25(23)38-30(33)24(28)16-32)36-31(34)29-19(4)27-18(3)13-17(2)14-26(27)37-29/h6-11,13-15,28H,5,12,33H2,1-4H3 |
| InChIKey | CKAPLPKWSZEMJV-UHFFFAOYSA-N |
| XLogP | 6.58 |
| TPSA | 107.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.57 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|